ChemNet > CAS > 26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
Produkt-Name |
2-[(4-chlorophenyl)thio]-3-nitropyridine |
Englischer Name |
2-[(4-chlorophenyl)thio]-3-nitropyridine;2-[(4-chlorophenyl)sulfanyl]-3-nitropyridine |
Molekulare Formel |
C11H7ClN2O2S |
Molecular Weight |
266.7035 |
InChI |
InChI=1/C11H7ClN2O2S/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H |
CAS Registry Number |
26820-31-5 |
Molecular Structure |
|
Dichte |
1.47g/cm3 |
Schmelzpunkt |
127℃ |
Siedepunkt |
398.4°C at 760 mmHg |
Brechungsindex |
1.68 |
Flammpunkt |
194.8°C |
Dampfdruck |
3.39E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|